C8H18N2O4S — CID 20644295
N-(1-hydroxypropan-2-yl)-2-(methanesulfonamido)-2-methylpropanamide (PubChem CID 20644295) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(1-hydroxypropan-2-yl)-2-(methanesulfonamido)-2-methylpropanamide.
| Compound Name | N-(1-hydroxypropan-2-yl)-2-(methanesulfonamido)-2-methylpropanamide |
|---|---|
| PubChem CID | 20644295 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-(1-hydroxypropan-2-yl)-2-(methanesulfonamido)-2-methylpropanamide |
| SMILES | CC(CO)NC(=O)C(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C8H18N2O4S/c1-6(5-11)9-7(12)8(2,3)10-15(4,13)14/h6,10-11H,5H2,1-4H3,(H,9,12) |
| InChIKey | DSLJHYJVEVZZRG-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |