About ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene
ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene (PubChem CID 20644327) has the molecular formula C9H20N4
and a molecular weight of 184.29 g/mol. Its IUPAC name is ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene.
Molecular Properties
| Compound Name | ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene |
| PubChem CID | 20644327 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene |
| SMILES | CC/N=N/C1C(C)N(C)N(C)C1C |
| InChI | InChI=1S/C9H20N4/c1-6-10-11-9-7(2)12(4)13(5)8(9)3/h7-9H,6H2,1-5H3/b11-10+ |
| InChIKey | VINKYPNHTTWBRB-ZHACJKMWSA-N |
| XLogP | 1.40 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
The IUPAC name of ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene (CID 20644327) is ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene.
What is the SMILES notation for ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
The canonical SMILES for ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene is CC/N=N/C1C(C)N(C)N(C)C1C.
What is the InChIKey of ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
The InChIKey is VINKYPNHTTWBRB-ZHACJKMWSA-N. The full InChI is InChI=1S/C9H20N4/c1-6-10-11-9-7(2)12(4)13(5)8(9)3/h7-9H,6H2,1-5H3/b11-10+.
What are the key properties of ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene has a molecular weight of 184.29 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene is sourced from PubChem (CID 20644327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).