About propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene
propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene (PubChem CID 20644328) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene.
Molecular Properties
| Compound Name | propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene |
| PubChem CID | 20644328 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene |
| SMILES | CC(C)/N=N/C1C(C)N(C)N(C)C1C |
| InChI | InChI=1S/C10H22N4/c1-7(2)11-12-10-8(3)13(5)14(6)9(10)4/h7-10H,1-6H3/b12-11+ |
| InChIKey | JYGDENTTXCQEJB-VAWYXSNFSA-N |
| XLogP | 1.78 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
The IUPAC name of propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene (CID 20644328) is propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene.
What is the SMILES notation for propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
The canonical SMILES for propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene is CC(C)/N=N/C1C(C)N(C)N(C)C1C.
What is the InChIKey of propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
The InChIKey is JYGDENTTXCQEJB-VAWYXSNFSA-N. The full InChI is InChI=1S/C10H22N4/c1-7(2)11-12-10-8(3)13(5)14(6)9(10)4/h7-10H,1-6H3/b12-11+.
What are the key properties of propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene?
propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene has a molecular weight of 198.31 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl-(1,2,3,5-tetramethylpyrazolidin-4-yl)diazene is sourced from PubChem (CID 20644328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).