About (1-acetylpiperidin-4-yl) acetate
(1-acetylpiperidin-4-yl) acetate (PubChem CID 20644464) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is (1-acetylpiperidin-4-yl) acetate.
Molecular Properties
| Compound Name | (1-acetylpiperidin-4-yl) acetate |
| PubChem CID | 20644464 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (1-acetylpiperidin-4-yl) acetate |
| SMILES | CC(=O)OC1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C9H15NO3/c1-7(11)10-5-3-9(4-6-10)13-8(2)12/h9H,3-6H2,1-2H3 |
| InChIKey | LEWUBPMRVABOOC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-acetylpiperidin-4-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetylpiperidin-4-yl) acetate?
The IUPAC name of (1-acetylpiperidin-4-yl) acetate (CID 20644464) is (1-acetylpiperidin-4-yl) acetate.
What is the SMILES notation for (1-acetylpiperidin-4-yl) acetate?
The canonical SMILES for (1-acetylpiperidin-4-yl) acetate is CC(=O)OC1CCN(C(C)=O)CC1.
What is the InChIKey of (1-acetylpiperidin-4-yl) acetate?
The InChIKey is LEWUBPMRVABOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-7(11)10-5-3-9(4-6-10)13-8(2)12/h9H,3-6H2,1-2H3.
What are the key properties of (1-acetylpiperidin-4-yl) acetate?
(1-acetylpiperidin-4-yl) acetate has a molecular weight of 185.22 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetylpiperidin-4-yl) acetate is sourced from PubChem (CID 20644464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).