About 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one
7-piperazin-1-yl-3H-1,3-benzoxazol-2-one (PubChem CID 20644640) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one |
| PubChem CID | 20644640 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cccc(N3CCNCC3)c2o1 |
| InChI | InChI=1S/C11H13N3O2/c15-11-13-8-2-1-3-9(10(8)16-11)14-6-4-12-5-7-14/h1-3,12H,4-7H2,(H,13,15) |
| InChIKey | BJJMRBXZMKJLQK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one?
The IUPAC name of 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one (CID 20644640) is 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one is O=c1[nH]c2cccc(N3CCNCC3)c2o1.
What is the InChIKey of 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one?
The InChIKey is BJJMRBXZMKJLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c15-11-13-8-2-1-3-9(10(8)16-11)14-6-4-12-5-7-14/h1-3,12H,4-7H2,(H,13,15).
What are the key properties of 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one?
7-piperazin-1-yl-3H-1,3-benzoxazol-2-one has a molecular weight of 219.24 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperazin-1-yl-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 20644640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).