About carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+)
carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) (PubChem CID 20644795) has the molecular formula C6H9N3V
and a molecular weight of 174.10 g/mol. Its IUPAC name is carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+).
Molecular Properties
| Compound Name | carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) |
| PubChem CID | 20644795 |
| Molecular Formula | C6H9N3V |
| Molecular Weight | 174.10 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) |
| SMILES | CNc1ccn[c-]n1.[CH3-].[V+2] |
| InChI | InChI=1S/C5H6N3.CH3.V/c1-6-5-2-3-7-4-8-5;;/h2-3H,1H3,(H,6,7,8);1H3;/q2*-1;+2 |
| InChIKey | ITARADDBHZJPEH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.10 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+)?
The IUPAC name of carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) (CID 20644795) is carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+).
What is the SMILES notation for carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+)?
The canonical SMILES for carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) is CNc1ccn[c-]n1.[CH3-].[V+2].
What is the InChIKey of carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+)?
The InChIKey is ITARADDBHZJPEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N3.CH3.V/c1-6-5-2-3-7-4-8-5;;/h2-3H,1H3,(H,6,7,8);1H3;/q2*-1;+2.
What are the key properties of carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+)?
carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) has a molecular weight of 174.10 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;N-methyl-2H-pyrimidin-2-id-4-amine;vanadium(2+) is sourced from PubChem (CID 20644795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).