About N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide
N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide (PubChem CID 20644845) has the molecular formula C8H13F2NO
and a molecular weight of 177.19 g/mol. Its IUPAC name is N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide.
Molecular Properties
| Compound Name | N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide |
| PubChem CID | 20644845 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide |
| SMILES | CCCC(=O)N(C)CC=C(F)F |
| InChI | InChI=1S/C8H13F2NO/c1-3-4-8(12)11(2)6-5-7(9)10/h5H,3-4,6H2,1-2H3 |
| InChIKey | DKMMJECKZRHGGB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide?
The IUPAC name of N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide (CID 20644845) is N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide.
What is the SMILES notation for N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide?
The canonical SMILES for N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide is CCCC(=O)N(C)CC=C(F)F.
What is the InChIKey of N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide?
The InChIKey is DKMMJECKZRHGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2NO/c1-3-4-8(12)11(2)6-5-7(9)10/h5H,3-4,6H2,1-2H3.
What are the key properties of N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide?
N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide has a molecular weight of 177.19 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluoroprop-2-enyl)-N-methylbutanamide is sourced from PubChem (CID 20644845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).