About 2-ethyl-4,5,6-trimethylpyridin-3-ol
2-ethyl-4,5,6-trimethylpyridin-3-ol (PubChem CID 20644950) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-ethyl-4,5,6-trimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 2-ethyl-4,5,6-trimethylpyridin-3-ol |
| PubChem CID | 20644950 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-ethyl-4,5,6-trimethylpyridin-3-ol |
| SMILES | CCc1nc(C)c(C)c(C)c1O |
| InChI | InChI=1S/C10H15NO/c1-5-9-10(12)7(3)6(2)8(4)11-9/h12H,5H2,1-4H3 |
| InChIKey | BSWDQQIFPPXVAE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4,5,6-trimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5,6-trimethylpyridin-3-ol?
The IUPAC name of 2-ethyl-4,5,6-trimethylpyridin-3-ol (CID 20644950) is 2-ethyl-4,5,6-trimethylpyridin-3-ol.
What is the SMILES notation for 2-ethyl-4,5,6-trimethylpyridin-3-ol?
The canonical SMILES for 2-ethyl-4,5,6-trimethylpyridin-3-ol is CCc1nc(C)c(C)c(C)c1O.
What is the InChIKey of 2-ethyl-4,5,6-trimethylpyridin-3-ol?
The InChIKey is BSWDQQIFPPXVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-5-9-10(12)7(3)6(2)8(4)11-9/h12H,5H2,1-4H3.
What are the key properties of 2-ethyl-4,5,6-trimethylpyridin-3-ol?
2-ethyl-4,5,6-trimethylpyridin-3-ol has a molecular weight of 165.24 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5,6-trimethylpyridin-3-ol is sourced from PubChem (CID 20644950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).