About 5,6-dimethyl-7-(methylamino)octane-2,3-dione
5,6-dimethyl-7-(methylamino)octane-2,3-dione (PubChem CID 20644971) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 5,6-dimethyl-7-(methylamino)octane-2,3-dione.
Molecular Properties
| Compound Name | 5,6-dimethyl-7-(methylamino)octane-2,3-dione |
| PubChem CID | 20644971 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 5,6-dimethyl-7-(methylamino)octane-2,3-dione |
| SMILES | CNC(C)C(C)C(C)CC(=O)C(C)=O |
| InChI | InChI=1S/C11H21NO2/c1-7(6-11(14)10(4)13)8(2)9(3)12-5/h7-9,12H,6H2,1-5H3 |
| InChIKey | LHBDQWJLPPAQMO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-7-(methylamino)octane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-7-(methylamino)octane-2,3-dione?
The IUPAC name of 5,6-dimethyl-7-(methylamino)octane-2,3-dione (CID 20644971) is 5,6-dimethyl-7-(methylamino)octane-2,3-dione.
What is the SMILES notation for 5,6-dimethyl-7-(methylamino)octane-2,3-dione?
The canonical SMILES for 5,6-dimethyl-7-(methylamino)octane-2,3-dione is CNC(C)C(C)C(C)CC(=O)C(C)=O.
What is the InChIKey of 5,6-dimethyl-7-(methylamino)octane-2,3-dione?
The InChIKey is LHBDQWJLPPAQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2/c1-7(6-11(14)10(4)13)8(2)9(3)12-5/h7-9,12H,6H2,1-5H3.
What are the key properties of 5,6-dimethyl-7-(methylamino)octane-2,3-dione?
5,6-dimethyl-7-(methylamino)octane-2,3-dione has a molecular weight of 199.29 g/mol, XLogP of 1.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-7-(methylamino)octane-2,3-dione is sourced from PubChem (CID 20644971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).