About 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane
2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane (PubChem CID 20645143) has the molecular formula C15H28
and a molecular weight of 208.39 g/mol. Its IUPAC name is 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane.
Analyze 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane?
The IUPAC name of 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane (CID 20645143) is 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane.
What is the SMILES notation for 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane?
The canonical SMILES for 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane is CC1CCC2C(C2(C)C)C1(C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane?
The InChIKey is QKZWBQHFKKQOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28/c1-10-8-9-11-12(14(11,5)6)15(10,7)13(2,3)4/h10-12H,8-9H2,1-7H3.
What are the key properties of 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane?
2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane has a molecular weight of 208.39 g/mol, XLogP of 4.74, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-2,3,7,7-tetramethylbicyclo[4.1.0]heptane is sourced from PubChem (CID 20645143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).