About CID 20645184
CID 20645184 (PubChem CID 20645184) has the molecular formula C4H8BIP
and a molecular weight of 224.80 g/mol.
Molecular Properties
| Compound Name | CID 20645184 |
| PubChem CID | 20645184 |
| Molecular Formula | C4H8BIP |
| Molecular Weight | 224.80 g/mol |
| Exact Mass | 224.95 |
| IUPAC Name | — |
| SMILES | C=CCP(I)[B]C |
| InChI | InChI=1S/C4H8BIP/c1-3-4-7(6)5-2/h3H,1,4H2,2H3 |
| InChIKey | BDGPZECOKTXTAE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 20645184 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20645184?
The IUPAC name of CID 20645184 (CID 20645184) is not available.
What is the SMILES notation for CID 20645184?
The canonical SMILES for CID 20645184 is C=CCP(I)[B]C.
What is the InChIKey of CID 20645184?
The InChIKey is BDGPZECOKTXTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BIP/c1-3-4-7(6)5-2/h3H,1,4H2,2H3.
What are the key properties of CID 20645184?
CID 20645184 has a molecular weight of 224.80 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20645184 is sourced from PubChem (CID 20645184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).