C13H15ClN6O3S2 — CID 20645254
2-amino-4-[(4-chloro-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid (PubChem CID 20645254) has the molecular formula C13H15ClN6O3S2 and a molecular weight of 402.89 g/mol. Its IUPAC name is 2-amino-4-[(4-chloro-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[(4-chloro-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 20645254 |
| Molecular Formula | C13H15ClN6O3S2 |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-amino-4-[(4-chloro-6-thiomorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzenesulfonic acid |
| SMILES | Nc1cc(Nc2nc(Cl)nc(N3CCSCC3)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C13H15ClN6O3S2/c14-11-17-12(19-13(18-11)20-3-5-24-6-4-20)16-8-1-2-10(9(15)7-8)25(21,22)23/h1-2,7H,3-6,15H2,(H,21,22,23)(H,16,17,18,19) |
| InChIKey | LDBXDZDRESONHB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|