C6H10N4 — CID 20645280
N,N,4-trimethyl-1,3,5-triazin-2-amine (PubChem CID 20645280) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is N,N,4-trimethyl-1,3,5-triazin-2-amine.
| Compound Name | N,N,4-trimethyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 20645280 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | N,N,4-trimethyl-1,3,5-triazin-2-amine |
| SMILES | Cc1ncnc(N(C)C)n1 |
| InChI | InChI=1S/C6H10N4/c1-5-7-4-8-6(9-5)10(2)3/h4H,1-3H3 |
| InChIKey | HHKPKUHIZXTEKR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |