About CID 20645300
CID 20645300 (PubChem CID 20645300) has the molecular formula C7H13BO
and a molecular weight of 123.99 g/mol.
Molecular Properties
| Compound Name | CID 20645300 |
| PubChem CID | 20645300 |
| Molecular Formula | C7H13BO |
| Molecular Weight | 123.99 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | — |
| SMILES | [B]C1CC(C)C(CC)O1 |
| InChI | InChI=1S/C7H13BO/c1-3-6-5(2)4-7(8)9-6/h5-7H,3-4H2,1-2H3 |
| InChIKey | NHXHOGSWNWQKKB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.99 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 20645300 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 20645300?
The IUPAC name of CID 20645300 (CID 20645300) is not available.
What is the SMILES notation for CID 20645300?
The canonical SMILES for CID 20645300 is [B]C1CC(C)C(CC)O1.
What is the InChIKey of CID 20645300?
The InChIKey is NHXHOGSWNWQKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13BO/c1-3-6-5(2)4-7(8)9-6/h5-7H,3-4H2,1-2H3.
What are the key properties of CID 20645300?
CID 20645300 has a molecular weight of 123.99 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 20645300 is sourced from PubChem (CID 20645300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).