C23H36O3 — CID 20645518
[(2E,4E,7Z)-6-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,7-trienyl] acetate (PubChem CID 20645518) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is [(2E,4E,7Z)-6-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,7-trienyl] acetate.
| Compound Name | [(2E,4E,7Z)-6-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,7-trienyl] acetate |
|---|---|
| PubChem CID | 20645518 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | [(2E,4E,7Z)-6-methoxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,7-trienyl] acetate |
| SMILES | COC(/C=C/C(C)=C/COC(C)=O)/C(C)=C\CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H36O3/c1-17(14-16-26-20(4)24)10-13-22(25-7)19(3)11-12-21-18(2)9-8-15-23(21,5)6/h10-11,13-14,22H,8-9,12,15-16H2,1-7H3/b13-10+,17-14+,19-11- |
| InChIKey | UDFOAQMVRNEFNE-SQHUQLSSSA-N |
| XLogP | 5.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|