About tetracyclo[6.6.0.02,6.010,14]tetradecane
tetracyclo[6.6.0.02,6.010,14]tetradecane (PubChem CID 20645753) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is tetracyclo[6.6.0.02,6.010,14]tetradecane.
Molecular Properties
| Compound Name | tetracyclo[6.6.0.02,6.010,14]tetradecane |
| PubChem CID | 20645753 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | tetracyclo[6.6.0.02,6.010,14]tetradecane |
| SMILES | C1CC2CC3CC4CCCC4C3C2C1 |
| InChI | InChI=1S/C14H22/c1-3-9-7-11-8-10-4-2-6-13(10)14(11)12(9)5-1/h9-14H,1-8H2 |
| InChIKey | CQOFOFNJTQULQJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetracyclo[6.6.0.02,6.010,14]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracyclo[6.6.0.02,6.010,14]tetradecane?
The IUPAC name of tetracyclo[6.6.0.02,6.010,14]tetradecane (CID 20645753) is tetracyclo[6.6.0.02,6.010,14]tetradecane.
What is the SMILES notation for tetracyclo[6.6.0.02,6.010,14]tetradecane?
The canonical SMILES for tetracyclo[6.6.0.02,6.010,14]tetradecane is C1CC2CC3CC4CCCC4C3C2C1.
What is the InChIKey of tetracyclo[6.6.0.02,6.010,14]tetradecane?
The InChIKey is CQOFOFNJTQULQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-3-9-7-11-8-10-4-2-6-13(10)14(11)12(9)5-1/h9-14H,1-8H2.
What are the key properties of tetracyclo[6.6.0.02,6.010,14]tetradecane?
tetracyclo[6.6.0.02,6.010,14]tetradecane has a molecular weight of 190.33 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetracyclo[6.6.0.02,6.010,14]tetradecane is sourced from PubChem (CID 20645753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).