C36H47N5O4S — CID 20646180
7-formyl-6-isocyano-2-[4-methyl-3-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 20646180) has the molecular formula C36H47N5O4S and a molecular weight of 645.87 g/mol. Its IUPAC name is 7-formyl-6-isocyano-2-[4-methyl-3-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | 7-formyl-6-isocyano-2-[4-methyl-3-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 20646180 |
| Molecular Formula | C36H47N5O4S |
| Molecular Weight | 645.87 g/mol |
| Exact Mass | 645.33 |
| IUPAC Name | 7-formyl-6-isocyano-2-[4-methyl-3-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenoxy]sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(C)c(NS(=O)Oc4cc(C(C)(C)CC(C)(C)C)ccc4OCCCCCCCC)c3)nc2c1C=O |
| InChI | InChI=1S/C36H47N5O4S/c1-9-10-11-12-13-14-19-44-31-18-17-27(36(6,7)24-35(3,4)5)21-32(31)45-46(43)40-29-20-26(16-15-25(29)2)33-38-34-28(23-42)30(37-8)22-41(34)39-33/h15-18,20-23,40H,9-14,19,24H2,1-7H3,(H,38,39) |
| InChIKey | WURSQCXNJJJPMQ-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.87 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|