C28H28ClN2O4S2+ — CID 20646181
4-[(2Z)-5-chloro-2-[(2Z)-2-[(1-methylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid (PubChem CID 20646181) has the molecular formula C28H28ClN2O4S2+ and a molecular weight of 556.13 g/mol. Its IUPAC name is 4-[(2Z)-5-chloro-2-[(2Z)-2-[(1-methylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[(2Z)-5-chloro-2-[(2Z)-2-[(1-methylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 20646181 |
| Molecular Formula | C28H28ClN2O4S2+ |
| Molecular Weight | 556.13 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | 4-[(2Z)-5-chloro-2-[(2Z)-2-[(1-methylbenzo[e][1,3]benzoxazol-1-ium-2-yl)methylidene]butylidene]-1,3-benzothiazol-3-yl]butane-1-sulfonic acid |
| SMILES | CCC(=C/c1oc2ccc3ccccc3c2[n+]1C)/C=C1\Sc2ccc(Cl)cc2N1CCCCS(=O)(=O)O |
| InChI | InChI=1S/C28H27ClN2O4S2/c1-3-19(16-26-30(2)28-22-9-5-4-8-20(22)10-12-24(28)35-26)17-27-31(14-6-7-15-37(32,33)34)23-18-21(29)11-13-25(23)36-27/h4-5,8-13,16-18H,3,6-7,14-15H2,1-2H3/p+1 |
| InChIKey | SVUADPPBNDHLQA-UHFFFAOYSA-O |
| XLogP | 6.98 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.13 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|