About N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide
N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 20646318) has the molecular formula C16H16ClN5O2
and a molecular weight of 345.79 g/mol. Its IUPAC name is N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
Molecular Properties
| Compound Name | N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| PubChem CID | 20646318 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | Cc1cc(N/C(=N/Cl)C(C)CN2C(=O)c3ccccc3C2=O)n[nH]1 |
| InChI | InChI=1S/C16H16ClN5O2/c1-9(14(19-17)18-13-7-10(2)20-21-13)8-22-15(23)11-5-3-4-6-12(11)16(22)24/h3-7,9H,8H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | RRCCFYNNANDIBA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide?
The IUPAC name of N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide (CID 20646318) is N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
What is the SMILES notation for N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide?
The canonical SMILES for N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide is Cc1cc(N/C(=N/Cl)C(C)CN2C(=O)c3ccccc3C2=O)n[nH]1.
What is the InChIKey of N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide?
The InChIKey is RRCCFYNNANDIBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClN5O2/c1-9(14(19-17)18-13-7-10(2)20-21-13)8-22-15(23)11-5-3-4-6-12(11)16(22)24/h3-7,9H,8H2,1-2H3,(H2,18,19,20,21).
What are the key properties of N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide?
N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide has a molecular weight of 345.79 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-chloro-3-(1,3-dioxoisoindol-2-yl)-2-methyl-N-(5-methyl-1H-pyrazol-3-yl)propanimidamide is sourced from PubChem (CID 20646318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).