About 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium
3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium (PubChem CID 20646579) has the molecular formula C12H25N3O5+2
and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium.
Molecular Properties
| Compound Name | 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium |
| PubChem CID | 20646579 |
| Molecular Formula | C12H25N3O5+2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium |
| SMILES | CC(=O)OCC(CNC(=O)C[NH2+]CCC[NH3+])OC(C)=O |
| InChI | InChI=1S/C12H23N3O5/c1-9(16)19-8-11(20-10(2)17)6-15-12(18)7-14-5-3-4-13/h11,14H,3-8,13H2,1-2H3,(H,15,18)/p+2 |
| InChIKey | QSSWYNNMTODCEJ-UHFFFAOYSA-P |
| XLogP | -3.21 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium?
The IUPAC name of 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium (CID 20646579) is 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium.
What is the SMILES notation for 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium?
The canonical SMILES for 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium is CC(=O)OCC(CNC(=O)C[NH2+]CCC[NH3+])OC(C)=O.
What is the InChIKey of 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium?
The InChIKey is QSSWYNNMTODCEJ-UHFFFAOYSA-P. The full InChI is InChI=1S/C12H23N3O5/c1-9(16)19-8-11(20-10(2)17)6-15-12(18)7-14-5-3-4-13/h11,14H,3-8,13H2,1-2H3,(H,15,18)/p+2.
What are the key properties of 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium?
3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium has a molecular weight of 291.35 g/mol, XLogP of -3.21, 10 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azaniumylpropyl-[2-(2,3-diacetyloxypropylamino)-2-oxoethyl]azanium is sourced from PubChem (CID 20646579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).