C6H6F3N3O4S — CID 20646801
(1,3-dimethyl-6-oxo-1,2,4-triazin-5-yl) trifluoromethanesulfonate (PubChem CID 20646801) has the molecular formula C6H6F3N3O4S and a molecular weight of 273.19 g/mol. Its IUPAC name is (1,3-dimethyl-6-oxo-1,2,4-triazin-5-yl) trifluoromethanesulfonate.
| Compound Name | (1,3-dimethyl-6-oxo-1,2,4-triazin-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 20646801 |
| Molecular Formula | C6H6F3N3O4S |
| Molecular Weight | 273.19 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (1,3-dimethyl-6-oxo-1,2,4-triazin-5-yl) trifluoromethanesulfonate |
| SMILES | Cc1nc(OS(=O)(=O)C(F)(F)F)c(=O)n(C)n1 |
| InChI | InChI=1S/C6H6F3N3O4S/c1-3-10-4(5(13)12(2)11-3)16-17(14,15)6(7,8)9/h1-2H3 |
| InChIKey | RYRSPWKDQZIMOQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|