C14H17F3N4O2S2 — CID 20647087
1,1,1-trifluoro-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide (PubChem CID 20647087) has the molecular formula C14H17F3N4O2S2 and a molecular weight of 394.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide |
|---|---|
| PubChem CID | 20647087 |
| Molecular Formula | C14H17F3N4O2S2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1,1,1-trifluoro-N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]methanesulfonamide |
| SMILES | O=S(=O)(NCCCCCNc1nc(-c2ccccn2)cs1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N4O2S2/c15-14(16,17)25(22,23)20-9-4-1-3-8-19-13-21-12(10-24-13)11-6-2-5-7-18-11/h2,5-7,10,20H,1,3-4,8-9H2,(H,19,21) |
| InChIKey | BOGGMEHYSZTNRH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|