About 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole
4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole (PubChem CID 20647090) has the molecular formula C13H19N5O2S2
and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole |
| PubChem CID | 20647090 |
| Molecular Formula | C13H19N5O2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole |
| SMILES | NS(=O)(=O)NCCCCCNc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C13H19N5O2S2/c14-22(19,20)17-9-4-1-3-8-16-13-18-12(10-21-13)11-6-2-5-7-15-11/h2,5-7,10,17H,1,3-4,8-9H2,(H,16,18)(H2,14,19,20) |
| InChIKey | MVIHVFVEMJXOIS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole?
The IUPAC name of 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole (CID 20647090) is 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole.
What is the SMILES notation for 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole?
The canonical SMILES for 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole is NS(=O)(=O)NCCCCCNc1nc(-c2ccccn2)cs1.
What is the InChIKey of 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole?
The InChIKey is MVIHVFVEMJXOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O2S2/c14-22(19,20)17-9-4-1-3-8-16-13-18-12(10-21-13)11-6-2-5-7-15-11/h2,5-7,10,17H,1,3-4,8-9H2,(H,16,18)(H2,14,19,20).
What are the key properties of 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole?
4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole has a molecular weight of 341.46 g/mol, XLogP of 1.58, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-2-yl-2-[5-(sulfamoylamino)pentylamino]-1,3-thiazole is sourced from PubChem (CID 20647090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).