C17H20N4O2S3 — CID 20647123
N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]thiophene-2-sulfonamide (PubChem CID 20647123) has the molecular formula C17H20N4O2S3 and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]thiophene-2-sulfonamide.
| Compound Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 20647123 |
| Molecular Formula | C17H20N4O2S3 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | N-[5-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]pentyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCCCNc1nc(-c2ccccn2)cs1)c1cccs1 |
| InChI | InChI=1S/C17H20N4O2S3/c22-26(23,16-8-6-12-24-16)20-11-4-1-3-10-19-17-21-15(13-25-17)14-7-2-5-9-18-14/h2,5-9,12-13,20H,1,3-4,10-11H2,(H,19,21) |
| InChIKey | FWKOPGKTNBSLLV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|