C32H42N4O — CID 20647330
N-[4-(diaminomethylideneamino)butyl]-N-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]naphthalene-2-carboxamide (PubChem CID 20647330) has the molecular formula C32H42N4O and a molecular weight of 498.72 g/mol. Its IUPAC name is N-[4-(diaminomethylideneamino)butyl]-N-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-(diaminomethylideneamino)butyl]-N-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 20647330 |
| Molecular Formula | C32H42N4O |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | N-[4-(diaminomethylideneamino)butyl]-N-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methyl]naphthalene-2-carboxamide |
| SMILES | Cc1cc2c(cc1CN(CCCCN=C(N)N)C(=O)c1ccc3ccccc3c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C32H42N4O/c1-22-18-27-28(32(4,5)15-14-31(27,2)3)20-26(22)21-36(17-9-8-16-35-30(33)34)29(37)25-13-12-23-10-6-7-11-24(23)19-25/h6-7,10-13,18-20H,8-9,14-17,21H2,1-5H3,(H4,33,34,35) |
| InChIKey | SUMOAPGYHZLZPQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|