About N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide
N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide (PubChem CID 20647612) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide.
Molecular Properties
| Compound Name | N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide |
| PubChem CID | 20647612 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide |
| SMILES | CC(=O)NC1CC(C)(C)CC(C)(NC(C)=O)C1 |
| InChI | InChI=1S/C13H24N2O2/c1-9(16)14-11-6-12(3,4)8-13(5,7-11)15-10(2)17/h11H,6-8H2,1-5H3,(H,14,16)(H,15,17) |
| InChIKey | JTZLBULSGGDWAW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide?
The IUPAC name of N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide (CID 20647612) is N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide.
What is the SMILES notation for N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide?
The canonical SMILES for N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide is CC(=O)NC1CC(C)(C)CC(C)(NC(C)=O)C1.
What is the InChIKey of N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide?
The InChIKey is JTZLBULSGGDWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-9(16)14-11-6-12(3,4)8-13(5,7-11)15-10(2)17/h11H,6-8H2,1-5H3,(H,14,16)(H,15,17).
What are the key properties of N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide?
N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide has a molecular weight of 240.35 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-acetamido-3,5,5-trimethylcyclohexyl)acetamide is sourced from PubChem (CID 20647612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).