About 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine
2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine (PubChem CID 20647691) has the molecular formula C18H14F6N2
and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine.
Molecular Properties
| Compound Name | 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine |
| PubChem CID | 20647691 |
| Molecular Formula | C18H14F6N2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine |
| SMILES | CC(=N\c1ccccc1C(F)(F)F)/C(C)=N/c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H14F6N2/c1-11(25-15-9-5-3-7-13(15)17(19,20)21)12(2)26-16-10-6-4-8-14(16)18(22,23)24/h3-10H,1-2H3/b25-11+,26-12+ |
| InChIKey | WPQJHEYRELZHGR-KOZSXFMUSA-N |
| XLogP | 6.61 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine?
The IUPAC name of 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine (CID 20647691) is 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine.
What is the SMILES notation for 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine?
The canonical SMILES for 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine is CC(=N\c1ccccc1C(F)(F)F)/C(C)=N/c1ccccc1C(F)(F)F.
What is the InChIKey of 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine?
The InChIKey is WPQJHEYRELZHGR-KOZSXFMUSA-N. The full InChI is InChI=1S/C18H14F6N2/c1-11(25-15-9-5-3-7-13(15)17(19,20)21)12(2)26-16-10-6-4-8-14(16)18(22,23)24/h3-10H,1-2H3/b25-11+,26-12+.
What are the key properties of 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine?
2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine has a molecular weight of 372.31 g/mol, XLogP of 6.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-bis[2-(trifluoromethyl)phenyl]butane-2,3-diimine is sourced from PubChem (CID 20647691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).