C3H12N4 — CID 20647754
N',N'-diamino-N-methylethane-1,2-diamine (PubChem CID 20647754) has the molecular formula C3H12N4 and a molecular weight of 104.16 g/mol. Its IUPAC name is N',N'-diamino-N-methylethane-1,2-diamine.
| Compound Name | N',N'-diamino-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 20647754 |
| Molecular Formula | C3H12N4 |
| Molecular Weight | 104.16 g/mol |
| Exact Mass | 104.11 |
| IUPAC Name | N',N'-diamino-N-methylethane-1,2-diamine |
| SMILES | CNCCN(N)N |
| InChI | InChI=1S/C3H12N4/c1-6-2-3-7(4)5/h6H,2-5H2,1H3 |
| InChIKey | BILTYKYDEBMPPL-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 104.16 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|