C27H33N5O4 — CID 20648085
(2,4,6-trimethylcyclohexyl) 5-[ethyl(methyl)carbamoyl]oxy-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20648085) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[ethyl(methyl)carbamoyl]oxy-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[ethyl(methyl)carbamoyl]oxy-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20648085 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[ethyl(methyl)carbamoyl]oxy-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1OC(=O)N(C)CC |
| InChI | InChI=1S/C27H33N5O4/c1-8-31(7)27(34)36-25-21(28-6)20(26(33)35-22-17(4)13-16(3)14-18(22)5)24-29-23(30-32(24)25)19-11-9-15(2)10-12-19/h9-12,16-18,22H,8,13-14H2,1-5,7H3,(H,29,30) |
| InChIKey | UKHVXDOMQPSBBD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|