C34H37N5O6 — CID 20648089
(2,6-dimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)propanoylamino]-4-methylphenyl]-5-formyloxy-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20648089) has the molecular formula C34H37N5O6 and a molecular weight of 611.70 g/mol. Its IUPAC name is (2,6-dimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)propanoylamino]-4-methylphenyl]-5-formyloxy-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-dimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)propanoylamino]-4-methylphenyl]-5-formyloxy-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20648089 |
| Molecular Formula | C34H37N5O6 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | (2,6-dimethylcyclohexyl) 2-[3-[2-(2,4-dimethylphenoxy)propanoylamino]-4-methylphenyl]-5-formyloxy-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CCCC2C)c2nc(-c3ccc(C)c(NC(=O)C(C)Oc4ccc(C)cc4C)c3)[nH]n2c1OC=O |
| InChI | InChI=1S/C34H37N5O6/c1-18-11-14-26(22(5)15-18)44-23(6)32(41)36-25-16-24(13-12-19(25)2)30-37-31-27(28(35-7)33(43-17-40)39(31)38-30)34(42)45-29-20(3)9-8-10-21(29)4/h11-17,20-21,23,29H,8-10H2,1-6H3,(H,36,41)(H,37,38) |
| InChIKey | JXPARIIAJUVMEJ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 128.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|