C19H21NO5 — CID 20648096
3-[2-(2,4-dimethylphenoxy)butanoyloxyamino]benzoic acid (PubChem CID 20648096) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[2-(2,4-dimethylphenoxy)butanoyloxyamino]benzoic acid.
| Compound Name | 3-[2-(2,4-dimethylphenoxy)butanoyloxyamino]benzoic acid |
|---|---|
| PubChem CID | 20648096 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[2-(2,4-dimethylphenoxy)butanoyloxyamino]benzoic acid |
| SMILES | CCC(Oc1ccc(C)cc1C)C(=O)ONc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H21NO5/c1-4-16(24-17-9-8-12(2)10-13(17)3)19(23)25-20-15-7-5-6-14(11-15)18(21)22/h5-11,16,20H,4H2,1-3H3,(H,21,22) |
| InChIKey | GFDBZKUIPUAJOD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|