About N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine
N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine (PubChem CID 20648171) has the molecular formula C8H22N2O3Si
and a molecular weight of 222.36 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine.
Molecular Properties
| Compound Name | N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine |
|---|
| PubChem CID | 20648171 |
|---|
| Molecular Formula | C8H22N2O3Si |
|---|
| Molecular Weight | 222.36 g/mol |
|---|
| Exact Mass | 222.14 |
|---|
| IUPAC Name | N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine |
|---|
| SMILES | CO[Si](CN(C)CN(C)C)(OC)OC |
|---|
| InChI | InChI=1S/C8H22N2O3Si/c1-9(2)7-10(3)8-14(11-4,12-5)13-6/h7-8H2,1-6H3 |
|---|
| InChIKey | NJOPAHUZWLCIIO-UHFFFAOYSA-N |
|---|
| XLogP | -0.15 |
|---|
| TPSA | 34.17 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 5 |
|---|
| Rotatable Bonds | 7 |
|---|
| Heavy Atoms | 14 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine?
The IUPAC name of N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine (CID 20648171) is N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine.
What is the SMILES notation for N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine?
The canonical SMILES for N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine is CO[Si](CN(C)CN(C)C)(OC)OC.
What is the InChIKey of N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine?
The InChIKey is NJOPAHUZWLCIIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H22N2O3Si/c1-9(2)7-10(3)8-14(11-4,12-5)13-6/h7-8H2,1-6H3.
What are the key properties of N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine?
N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine has a molecular weight of 222.36 g/mol, XLogP of -0.15, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,N'-trimethyl-N'-(trimethoxysilylmethyl)methanediamine is sourced from PubChem (CID 20648171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).