C8H12N2O2 — CID 20648223
5-methyl-2,3,6,7-tetrahydro-1,5-diazonine-4,8-dione (PubChem CID 20648223) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-methyl-2,3,6,7-tetrahydro-1,5-diazonine-4,8-dione.
| Compound Name | 5-methyl-2,3,6,7-tetrahydro-1,5-diazonine-4,8-dione |
|---|---|
| PubChem CID | 20648223 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 5-methyl-2,3,6,7-tetrahydro-1,5-diazonine-4,8-dione |
| SMILES | CN1CCC(=O)/C=N\CCC1=O |
| InChI | InChI=1S/C8H12N2O2/c1-10-5-3-7(11)6-9-4-2-8(10)12/h6H,2-5H2,1H3/b9-6- |
| InChIKey | YBULGAWDHGUROS-TWGQIWQCSA-N |
| XLogP | -0.12 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |