C11H21NO7 — CID 20648225
2-methyl-3-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide (PubChem CID 20648225) has the molecular formula C11H21NO7 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-methyl-3-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide.
| Compound Name | 2-methyl-3-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide |
|---|---|
| PubChem CID | 20648225 |
| Molecular Formula | C11H21NO7 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-methyl-3-oxo-N-(2,3,4,5,6-pentahydroxyhexyl)butanamide |
| SMILES | CC(=O)C(C)C(=O)NCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C11H21NO7/c1-5(6(2)14)11(19)12-3-7(15)9(17)10(18)8(16)4-13/h5,7-10,13,15-18H,3-4H2,1-2H3,(H,12,19) |
| InChIKey | FVXSSAPNAORNFY-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|