About 2,5-dichloro-3,4,6-trimethylbenzoic acid
2,5-dichloro-3,4,6-trimethylbenzoic acid (PubChem CID 20648398) has the molecular formula C10H10Cl2O2
and a molecular weight of 233.09 g/mol. Its IUPAC name is 2,5-dichloro-3,4,6-trimethylbenzoic acid.
Molecular Properties
| Compound Name | 2,5-dichloro-3,4,6-trimethylbenzoic acid |
| PubChem CID | 20648398 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2,5-dichloro-3,4,6-trimethylbenzoic acid |
| SMILES | Cc1c(C)c(Cl)c(C(=O)O)c(C)c1Cl |
| InChI | InChI=1S/C10H10Cl2O2/c1-4-5(2)9(12)7(10(13)14)6(3)8(4)11/h1-3H3,(H,13,14) |
| InChIKey | OUEANAKQKQUOEB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,5-dichloro-3,4,6-trimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-3,4,6-trimethylbenzoic acid?
The IUPAC name of 2,5-dichloro-3,4,6-trimethylbenzoic acid (CID 20648398) is 2,5-dichloro-3,4,6-trimethylbenzoic acid.
What is the SMILES notation for 2,5-dichloro-3,4,6-trimethylbenzoic acid?
The canonical SMILES for 2,5-dichloro-3,4,6-trimethylbenzoic acid is Cc1c(C)c(Cl)c(C(=O)O)c(C)c1Cl.
What is the InChIKey of 2,5-dichloro-3,4,6-trimethylbenzoic acid?
The InChIKey is OUEANAKQKQUOEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2O2/c1-4-5(2)9(12)7(10(13)14)6(3)8(4)11/h1-3H3,(H,13,14).
What are the key properties of 2,5-dichloro-3,4,6-trimethylbenzoic acid?
2,5-dichloro-3,4,6-trimethylbenzoic acid has a molecular weight of 233.09 g/mol, XLogP of 3.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-3,4,6-trimethylbenzoic acid is sourced from PubChem (CID 20648398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).