About 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione
1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione (PubChem CID 20648635) has the molecular formula C7H13NS3
and a molecular weight of 207.39 g/mol. Its IUPAC name is 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione.
Molecular Properties
| Compound Name | 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione |
| PubChem CID | 20648635 |
| Molecular Formula | C7H13NS3 |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione |
| SMILES | CCC(=S)N1CSCC1CS |
| InChI | InChI=1S/C7H13NS3/c1-2-7(10)8-5-11-4-6(8)3-9/h6,9H,2-5H2,1H3 |
| InChIKey | PRLDTOLTJWMZHB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione?
The IUPAC name of 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione (CID 20648635) is 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione.
What is the SMILES notation for 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione?
The canonical SMILES for 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione is CCC(=S)N1CSCC1CS.
What is the InChIKey of 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione?
The InChIKey is PRLDTOLTJWMZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS3/c1-2-7(10)8-5-11-4-6(8)3-9/h6,9H,2-5H2,1H3.
What are the key properties of 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione?
1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione has a molecular weight of 207.39 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(sulfanylmethyl)-1,3-thiazolidin-3-yl]propane-1-thione is sourced from PubChem (CID 20648635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).