About 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde
2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde (PubChem CID 20648673) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde |
| PubChem CID | 20648673 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde |
| SMILES | CNc1ncc(CC=O)s1 |
| InChI | InChI=1S/C6H8N2OS/c1-7-6-8-4-5(10-6)2-3-9/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | TZFGSNCMWSSMSG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde?
The IUPAC name of 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde (CID 20648673) is 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde.
What is the SMILES notation for 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde?
The canonical SMILES for 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde is CNc1ncc(CC=O)s1.
What is the InChIKey of 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde?
The InChIKey is TZFGSNCMWSSMSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-7-6-8-4-5(10-6)2-3-9/h3-4H,2H2,1H3,(H,7,8).
What are the key properties of 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde?
2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde has a molecular weight of 156.21 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(methylamino)-1,3-thiazol-5-yl]acetaldehyde is sourced from PubChem (CID 20648673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).