About methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate
methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate (PubChem CID 20649180) has the molecular formula C23H21F2NO3
and a molecular weight of 397.42 g/mol. Its IUPAC name is methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate.
Molecular Properties
| Compound Name | methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate |
| PubChem CID | 20649180 |
| Molecular Formula | C23H21F2NO3 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(CONCc2cc(F)cc(F)c2)cc1-c1ccccc1C |
| InChI | InChI=1S/C23H21F2NO3/c1-15-5-3-4-6-20(15)22-11-16(7-8-21(22)23(27)28-2)14-29-26-13-17-9-18(24)12-19(25)10-17/h3-12,26H,13-14H2,1-2H3 |
| InChIKey | HKFWIPLNXNJTMM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate?
The IUPAC name of methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate (CID 20649180) is methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate.
What is the SMILES notation for methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate?
The canonical SMILES for methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate is COC(=O)c1ccc(CONCc2cc(F)cc(F)c2)cc1-c1ccccc1C.
What is the InChIKey of methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate?
The InChIKey is HKFWIPLNXNJTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2NO3/c1-15-5-3-4-6-20(15)22-11-16(7-8-21(22)23(27)28-2)14-29-26-13-17-9-18(24)12-19(25)10-17/h3-12,26H,13-14H2,1-2H3.
What are the key properties of methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate?
methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate has a molecular weight of 397.42 g/mol, XLogP of 4.95, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(3,5-difluorophenyl)methylamino]oxymethyl]-2-(2-methylphenyl)benzoate is sourced from PubChem (CID 20649180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).