C11H11Cl2N5O3S — CID 20649635
2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]benzenesulfonic acid (PubChem CID 20649635) has the molecular formula C11H11Cl2N5O3S and a molecular weight of 364.21 g/mol. Its IUPAC name is 2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]benzenesulfonic acid.
| Compound Name | 2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 20649635 |
| Molecular Formula | C11H11Cl2N5O3S |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 2-amino-4-[(4,6-dichloro-1,3,5-triazin-2-yl)-ethylamino]benzenesulfonic acid |
| SMILES | CCN(c1ccc(S(=O)(=O)O)c(N)c1)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C11H11Cl2N5O3S/c1-2-18(11-16-9(12)15-10(13)17-11)6-3-4-8(7(14)5-6)22(19,20)21/h3-5H,2,14H2,1H3,(H,19,20,21) |
| InChIKey | RRAHDZSLVOMAIR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|