C25H32O6 — CID 20649919
[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxymethyl)-2-(prop-2-enoyloxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 20649919) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is [2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxymethyl)-2-(prop-2-enoyloxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxymethyl)-2-(prop-2-enoyloxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 20649919 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | [2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxymethyl)-2-(prop-2-enoyloxymethyl)butyl] bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C1CC2C=CC1C2)COC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C25H32O6/c1-3-22(26)29-13-25(4-2,14-30-23(27)20-11-16-5-7-18(20)9-16)15-31-24(28)21-12-17-6-8-19(21)10-17/h3,5-8,16-21H,1,4,9-15H2,2H3 |
| InChIKey | JAHXLVNSVSMVLF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|