C34H34NO12Sb — CID 20650168
7-[3-(1,3,2-benzodioxastibol-2-ylamino)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 20650168) has the molecular formula C34H34NO12Sb and a molecular weight of 770.40 g/mol. Its IUPAC name is 7-[3-(1,3,2-benzodioxastibol-2-ylamino)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 7-[3-(1,3,2-benzodioxastibol-2-ylamino)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 20650168 |
| Molecular Formula | C34H34NO12Sb |
| Molecular Weight | 770.40 g/mol |
| Exact Mass | 769.11 |
| IUPAC Name | 7-[3-(1,3,2-benzodioxastibol-2-ylamino)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CO)CC3OC1CC(C)C(O)C(N[Sb]2Oc3ccccc3O2)C1 |
| InChI | InChI=1S/C28H30NO10.C6H6O2.Sb/c1-11-6-12(7-15(29)23(11)32)39-17-9-28(37,18(31)10-30)8-14-20(17)27(36)22-21(25(14)34)24(33)13-4-3-5-16(38-2)19(13)26(22)35;7-5-3-1-2-4-6(5)8;/h3-5,11-12,15,17,23,29-30,32,34,36-37H,6-10H2,1-2H3;1-4,7-8H;/q-1;;+3/p-2 |
| InChIKey | CKSQTMNGNOAREB-UHFFFAOYSA-L |
| XLogP | 1.75 |
| TPSA | 201.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|