C28H31NO10 — CID 20650169
7-(3-amino-4-hydroxy-5-methylcyclohexyl)oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 20650169) has the molecular formula C28H31NO10 and a molecular weight of 541.55 g/mol. Its IUPAC name is 7-(3-amino-4-hydroxy-5-methylcyclohexyl)oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | 7-(3-amino-4-hydroxy-5-methylcyclohexyl)oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 20650169 |
| Molecular Formula | C28H31NO10 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 7-(3-amino-4-hydroxy-5-methylcyclohexyl)oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CO)CC3OC1CC(C)C(O)C(N)C1 |
| InChI | InChI=1S/C28H31NO10/c1-11-6-12(7-15(29)23(11)32)39-17-9-28(37,18(31)10-30)8-14-20(17)27(36)22-21(25(14)34)24(33)13-4-3-5-16(38-2)19(13)26(22)35/h3-5,11-12,15,17,23,30,32,34,36-37H,6-10,29H2,1-2H3 |
| InChIKey | SYYUQHRCUNIQBS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 196.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|