About 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate
1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate (PubChem CID 20650542) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate.
Molecular Properties
| Compound Name | 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate |
| PubChem CID | 20650542 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate |
| SMILES | CCOC(C)OC(=O)C1CC2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C15H24O3/c1-3-17-9(2)18-15(16)12-7-13-10-4-5-11(6-10)14(13)8-12/h9-14H,3-8H2,1-2H3 |
| InChIKey | IBXVYTYCVHUHQC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate?
The IUPAC name of 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate (CID 20650542) is 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate.
What is the SMILES notation for 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate?
The canonical SMILES for 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate is CCOC(C)OC(=O)C1CC2C3CCC(C3)C2C1.
What is the InChIKey of 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate?
The InChIKey is IBXVYTYCVHUHQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-17-9(2)18-15(16)12-7-13-10-4-5-11(6-10)14(13)8-12/h9-14H,3-8H2,1-2H3.
What are the key properties of 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate?
1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate has a molecular weight of 252.35 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethyl tricyclo[5.2.1.02,6]decane-4-carboxylate is sourced from PubChem (CID 20650542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).