C12H17N2O2S- — CID 20650568
8-methyl-9-(sulfinatoamino)-1,2,3,4,5,6-hexahydro-1-benzazocine (PubChem CID 20650568) has the molecular formula C12H17N2O2S- and a molecular weight of 253.35 g/mol. Its IUPAC name is 8-methyl-9-(sulfinatoamino)-1,2,3,4,5,6-hexahydro-1-benzazocine.
| Compound Name | 8-methyl-9-(sulfinatoamino)-1,2,3,4,5,6-hexahydro-1-benzazocine |
|---|---|
| PubChem CID | 20650568 |
| Molecular Formula | C12H17N2O2S- |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 8-methyl-9-(sulfinatoamino)-1,2,3,4,5,6-hexahydro-1-benzazocine |
| SMILES | Cc1cc2c(cc1NS(=O)[O-])NCCCCC2 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-7-10-5-3-2-4-6-13-12(10)8-11(9)14-17(15)16/h7-8,13-14H,2-6H2,1H3,(H,15,16)/p-1 |
| InChIKey | UHVDGYLSUBKBDQ-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|