C18H22N6 — CID 20650588
1-methyl-3-[(1,2,3,3,6-pentamethyl-2H-indol-5-yl)diazenyl]pyrazole-4-carbonitrile (PubChem CID 20650588) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-methyl-3-[(1,2,3,3,6-pentamethyl-2H-indol-5-yl)diazenyl]pyrazole-4-carbonitrile.
| Compound Name | 1-methyl-3-[(1,2,3,3,6-pentamethyl-2H-indol-5-yl)diazenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 20650588 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 1-methyl-3-[(1,2,3,3,6-pentamethyl-2H-indol-5-yl)diazenyl]pyrazole-4-carbonitrile |
| SMILES | Cc1cc2c(cc1/N=N/c1nn(C)cc1C#N)C(C)(C)C(C)N2C |
| InChI | InChI=1S/C18H22N6/c1-11-7-16-14(18(3,4)12(2)24(16)6)8-15(11)20-21-17-13(9-19)10-23(5)22-17/h7-8,10,12H,1-6H3/b21-20+ |
| InChIKey | SHSGXBKFPJINEX-QZQOTICOSA-N |
| XLogP | 4.13 |
| TPSA | 69.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|