About N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline
N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline (PubChem CID 20650793) has the molecular formula C18H26N4S
and a molecular weight of 330.50 g/mol. Its IUPAC name is N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline.
Molecular Properties
| Compound Name | N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline |
| PubChem CID | 20650793 |
| Molecular Formula | C18H26N4S |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline |
| SMILES | CCCCN(CCCC)c1ccc(/N=N/c2nccs2)c(C)c1 |
| InChI | InChI=1S/C18H26N4S/c1-4-6-11-22(12-7-5-2)16-8-9-17(15(3)14-16)20-21-18-19-10-13-23-18/h8-10,13-14H,4-7,11-12H2,1-3H3/b21-20+ |
| InChIKey | WNWVISXOSZZHFM-QZQOTICOSA-N |
| XLogP | 6.27 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline?
The IUPAC name of N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline (CID 20650793) is N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline.
What is the SMILES notation for N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline?
The canonical SMILES for N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline is CCCCN(CCCC)c1ccc(/N=N/c2nccs2)c(C)c1.
What is the InChIKey of N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline?
The InChIKey is WNWVISXOSZZHFM-QZQOTICOSA-N. The full InChI is InChI=1S/C18H26N4S/c1-4-6-11-22(12-7-5-2)16-8-9-17(15(3)14-16)20-21-18-19-10-13-23-18/h8-10,13-14H,4-7,11-12H2,1-3H3/b21-20+.
What are the key properties of N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline?
N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline has a molecular weight of 330.50 g/mol, XLogP of 6.27, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-3-methyl-4-(1,3-thiazol-2-yldiazenyl)aniline is sourced from PubChem (CID 20650793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).