C18H21F4N3O2S2 — CID 20651581
2,2,2-trifluoro-N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]ethanesulfonamide (PubChem CID 20651581) has the molecular formula C18H21F4N3O2S2 and a molecular weight of 451.51 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]ethanesulfonamide |
|---|---|
| PubChem CID | 20651581 |
| Molecular Formula | C18H21F4N3O2S2 |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]butyl]ethanesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)NCCCCNc1nc2c(s1)CCCc1ccc(F)cc1-2 |
| InChI | InChI=1S/C18H21F4N3O2S2/c19-13-7-6-12-4-3-5-15-16(14(12)10-13)25-17(28-15)23-8-1-2-9-24-29(26,27)11-18(20,21)22/h6-7,10,24H,1-5,8-9,11H2,(H,23,25) |
| InChIKey | LSOXJBOIOVVGQF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|