C20H28FN3O2S2 — CID 20651605
N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]propane-2-sulfonamide (PubChem CID 20651605) has the molecular formula C20H28FN3O2S2 and a molecular weight of 425.60 g/mol. Its IUPAC name is N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]propane-2-sulfonamide.
| Compound Name | N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 20651605 |
| Molecular Formula | C20H28FN3O2S2 |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[5-[(13-fluoro-5-thia-3-azatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),3,11,13-pentaen-4-yl)amino]pentyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)NCCCCCNc1nc2c(s1)CCCc1ccc(F)cc1-2 |
| InChI | InChI=1S/C20H28FN3O2S2/c1-14(2)28(25,26)23-12-5-3-4-11-22-20-24-19-17-13-16(21)10-9-15(17)7-6-8-18(19)27-20/h9-10,13-14,23H,3-8,11-12H2,1-2H3,(H,22,24) |
| InChIKey | SGGBULVSXBNZCT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|