About N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide
N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide (PubChem CID 20651628) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide |
| PubChem CID | 20651628 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)CC(C)(C)CN(C)C |
| InChI | InChI=1S/C10H22N2O/c1-9(13)12(6)8-10(2,3)7-11(4)5/h7-8H2,1-6H3 |
| InChIKey | HUTSJAWOXSZSMY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide?
The IUPAC name of N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide (CID 20651628) is N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide.
What is the SMILES notation for N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide?
The canonical SMILES for N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide is CC(=O)N(C)CC(C)(C)CN(C)C.
What is the InChIKey of N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide?
The InChIKey is HUTSJAWOXSZSMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-9(13)12(6)8-10(2,3)7-11(4)5/h7-8H2,1-6H3.
What are the key properties of N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide?
N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide has a molecular weight of 186.30 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(dimethylamino)-2,2-dimethylpropyl]-N-methylacetamide is sourced from PubChem (CID 20651628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).