C42H26F12O6S — CID 20651921
4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenol (PubChem CID 20651921) has the molecular formula C42H26F12O6S and a molecular weight of 886.71 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 20651921 |
| Molecular Formula | C42H26F12O6S |
| Molecular Weight | 886.71 g/mol |
| Exact Mass | 886.13 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-[4-[4-[4-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]phenyl]sulfonylphenoxy]phenyl]propan-2-yl]phenol |
| SMILES | O=S(=O)(c1ccc(Oc2ccc(C(c3ccc(O)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1)c1ccc(Oc2ccc(C(c3ccc(O)cc3)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C42H26F12O6S/c43-39(44,45)37(40(46,47)48,25-1-9-29(55)10-2-25)27-5-13-31(14-6-27)59-33-17-21-35(22-18-33)61(57,58)36-23-19-34(20-24-36)60-32-15-7-28(8-16-32)38(41(49,50)51,42(52,53)54)26-3-11-30(56)12-4-26/h1-24,55-56H |
| InChIKey | CHDMKRNWRANXJL-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.71 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |